ChemNet > CAS > 220227-37-2 3,4,5-trifluorobenzyl alcohol
220227-37-2 3,4,5-trifluorobenzyl alcohol
نام محصول |
3,4,5-trifluorobenzyl alcohol |
مترادف |
3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
میدان مغناطیسی |
C7H5F3O |
وزن مولکولی |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
شماره سیایاس |
220227-37-2 |
ساختار مولکولی |
|
تراکم |
1.398g/cm3 |
نقطه غلیان |
192.1°C at 760 mmHg |
ضریب شکست |
1.476 |
نقطه اشتعال |
83°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|